C27H37N3O4 — CID 10504445
(2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N'-hydroxy-2-(3-phenylpropyl)butanediamide (PubChem CID 10504445) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N'-hydroxy-2-(3-phenylpropyl)butanediamide.
| Compound Name | (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N'-hydroxy-2-(3-phenylpropyl)butanediamide |
|---|---|
| PubChem CID | 10504445 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (2R)-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N'-hydroxy-2-(3-phenylpropyl)butanediamide |
| SMILES | C[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCc1ccccc1)CC(=O)NO)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O4/c1-19(21-15-9-6-10-16-21)28-26(33)24(27(2,3)4)29-25(32)22(18-23(31)30-34)17-11-14-20-12-7-5-8-13-20/h5-10,12-13,15-16,19,22,24,34H,11,14,17-18H2,1-4H3,(H,28,33)(H,29,32)(H,30,31)/t19-,22+,24+/m0/s1 |
| InChIKey | XAHWTAYXASVGFG-BPUDTRNYSA-N |
| XLogP | 3.93 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|