C17H18BrNOS — CID 105045202
N-[(3-bromothiophen-2-yl)-(5-methyl-1-benzofuran-2-yl)methyl]propan-1-amine (PubChem CID 105045202) has the molecular formula C17H18BrNOS and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)-(5-methyl-1-benzofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)-(5-methyl-1-benzofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105045202 |
| Molecular Formula | C17H18BrNOS |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)-(5-methyl-1-benzofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc2cc(C)ccc2o1)c1sccc1Br |
| InChI | InChI=1S/C17H18BrNOS/c1-3-7-19-16(17-13(18)6-8-21-17)15-10-12-9-11(2)4-5-14(12)20-15/h4-6,8-10,16,19H,3,7H2,1-2H3 |
| InChIKey | XBFDKPCRPKCQSM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |