C27H39N3O4 — CID 10504531
(3S)-3-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl-propylamino]-N-methyl-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 10504531) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is (3S)-3-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl-propylamino]-N-methyl-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | (3S)-3-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl-propylamino]-N-methyl-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 10504531 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | (3S)-3-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl-propylamino]-N-methyl-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | CCCN(CCCCN1C(=O)CC2(CCCC2)CC1=O)[C@@H]1COc2cccc(C(=O)NC)c2C1 |
| InChI | InChI=1S/C27H39N3O4/c1-3-13-29(20-16-22-21(26(33)28-2)9-8-10-23(22)34-19-20)14-6-7-15-30-24(31)17-27(18-25(30)32)11-4-5-12-27/h8-10,20H,3-7,11-19H2,1-2H3,(H,28,33)/t20-/m0/s1 |
| InChIKey | CADNWDWVMFMZHL-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|