C16H13Cl2NO — CID 105045662
(2,3-dichlorophenyl)-(7-methyl-1-benzofuran-2-yl)methanamine (PubChem CID 105045662) has the molecular formula C16H13Cl2NO and a molecular weight of 306.19 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(7-methyl-1-benzofuran-2-yl)methanamine.
| Compound Name | (2,3-dichlorophenyl)-(7-methyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 105045662 |
| Molecular Formula | C16H13Cl2NO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2,3-dichlorophenyl)-(7-methyl-1-benzofuran-2-yl)methanamine |
| SMILES | Cc1cccc2cc(C(N)c3cccc(Cl)c3Cl)oc12 |
| InChI | InChI=1S/C16H13Cl2NO/c1-9-4-2-5-10-8-13(20-16(9)10)15(19)11-6-3-7-12(17)14(11)18/h2-8,15H,19H2,1H3 |
| InChIKey | NECUNYGQUFVVKM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |