C16H12BrClFNO — CID 105045763
1-(2-bromo-5-fluorophenyl)-1-(5-chloro-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 105045763) has the molecular formula C16H12BrClFNO and a molecular weight of 368.63 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-1-(5-chloro-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-1-(5-chloro-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105045763 |
| Molecular Formula | C16H12BrClFNO |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-1-(5-chloro-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cc(Cl)ccc2o1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C16H12BrClFNO/c1-20-16(12-8-11(19)3-4-13(12)17)15-7-9-6-10(18)2-5-14(9)21-15/h2-8,16,20H,1H3 |
| InChIKey | XEIXNQNNXXHFDE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |