C18H26ClNO — CID 105045797
1-(5-chloro-1-benzofuran-2-yl)-N,2-diethylhexan-1-amine (PubChem CID 105045797) has the molecular formula C18H26ClNO and a molecular weight of 307.86 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-N,2-diethylhexan-1-amine.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-N,2-diethylhexan-1-amine |
|---|---|
| PubChem CID | 105045797 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-N,2-diethylhexan-1-amine |
| SMILES | CCCCC(CC)C(NCC)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C18H26ClNO/c1-4-7-8-13(5-2)18(20-6-3)17-12-14-11-15(19)9-10-16(14)21-17/h9-13,18,20H,4-8H2,1-3H3 |
| InChIKey | AFUQLTLKMQCQGK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |