C14H14ClN3S — CID 105046623
1-(1-benzothiophen-3-yl)-1-(4-chloro-1-methylpyrazol-5-yl)-N-methylmethanamine (PubChem CID 105046623) has the molecular formula C14H14ClN3S and a molecular weight of 291.81 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-1-(4-chloro-1-methylpyrazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-1-(4-chloro-1-methylpyrazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105046623 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-1-(4-chloro-1-methylpyrazol-5-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc2ccccc12)c1c(Cl)cnn1C |
| InChI | InChI=1S/C14H14ClN3S/c1-16-13(14-11(15)7-17-18(14)2)10-8-19-12-6-4-3-5-9(10)12/h3-8,13,16H,1-2H3 |
| InChIKey | BVJYSFVNPXPESF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |