C11H18ClN3O — CID 105046718
1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(oxan-2-yl)methanamine (PubChem CID 105046718) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(oxan-2-yl)methanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 105046718 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(oxan-2-yl)methanamine |
| SMILES | CNC(c1c(Cl)cnn1C)C1CCCCO1 |
| InChI | InChI=1S/C11H18ClN3O/c1-13-10(9-5-3-4-6-16-9)11-8(12)7-14-15(11)2/h7,9-10,13H,3-6H2,1-2H3 |
| InChIKey | CNXADCXBRCKWMC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |