C28H29NO6 — CID 10504744
dimethyl (2S,5S)-2,5-dibenzoyl-1-cyclohexyl-2,5-dihydropyrrole-3,4-dicarboxylate (PubChem CID 10504744) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is dimethyl (2S,5S)-2,5-dibenzoyl-1-cyclohexyl-2,5-dihydropyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,5S)-2,5-dibenzoyl-1-cyclohexyl-2,5-dihydropyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10504744 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | dimethyl (2S,5S)-2,5-dibenzoyl-1-cyclohexyl-2,5-dihydropyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H](C(=O)c2ccccc2)N(C2CCCCC2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29NO6/c1-34-27(32)21-22(28(33)35-2)24(26(31)19-14-8-4-9-15-19)29(20-16-10-5-11-17-20)23(21)25(30)18-12-6-3-7-13-18/h3-4,6-9,12-15,20,23-24H,5,10-11,16-17H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | YAAZKASFXBDEIH-ZEQRLZLVSA-N |
| XLogP | 3.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |