C17H29N3O — CID 105048734
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-1-propylpyrazol-5-yl)-N-methylethanamine (PubChem CID 105048734) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-1-propylpyrazol-5-yl)-N-methylethanamine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-1-propylpyrazol-5-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105048734 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-methoxy-1-propylpyrazol-5-yl)-N-methylethanamine |
| SMILES | CCCn1ncc(OC)c1C(CC1CC2CCC1C2)NC |
| InChI | InChI=1S/C17H29N3O/c1-4-7-20-17(16(21-3)11-19-20)15(18-2)10-14-9-12-5-6-13(14)8-12/h11-15,18H,4-10H2,1-3H3 |
| InChIKey | KYQDUOIFEDXDOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |