C14H16F3N3O — CID 105049951
3-(1-methylimidazol-2-yl)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 105049951) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 3-(1-methylimidazol-2-yl)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 105049951 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | Cn1ccnc1CCC(N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3O/c1-20-9-8-19-13(20)7-6-12(18)10-2-4-11(5-3-10)21-14(15,16)17/h2-5,8-9,12H,6-7,18H2,1H3 |
| InChIKey | CCEYAPOEDJFEBR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |