C26H34O5SSi — CID 10505113
[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10505113) has the molecular formula C26H34O5SSi and a molecular weight of 486.71 g/mol. Its IUPAC name is [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10505113 |
| Molecular Formula | C26H34O5SSi |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC12C3(S(=O)(=O)c4ccccc4)[C@@H]4C=C[C@@]1(CCC[C@]21C=C[C@H]3O1)O4 |
| InChI | InChI=1S/C26H34O5SSi/c1-22(2,3)33(4,5)29-18-25-23-14-9-15-24(25)17-13-21(31-24)26(25,20(30-23)12-16-23)32(27,28)19-10-7-6-8-11-19/h6-8,10-13,16-17,20-21H,9,14-15,18H2,1-5H3/t20-,21+,23+,24-,25?,26? |
| InChIKey | XYARGNHIGBOWDB-YTCNBXCASA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|