C16H26FN — CID 105051216
1-(4-fluoro-2-methylphenyl)-3-propylhexan-2-amine (PubChem CID 105051216) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-3-propylhexan-2-amine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 105051216 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(N)Cc1ccc(F)cc1C |
| InChI | InChI=1S/C16H26FN/c1-4-6-13(7-5-2)16(18)11-14-8-9-15(17)10-12(14)3/h8-10,13,16H,4-7,11,18H2,1-3H3 |
| InChIKey | UEIWGCKARJWJQF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |