About [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane
[2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane (PubChem CID 10505167) has the molecular formula C32H48Si2
and a molecular weight of 488.91 g/mol. Its IUPAC name is [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane.
Molecular Properties
| Compound Name | [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane |
| PubChem CID | 10505167 |
| Molecular Formula | C32H48Si2 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane |
| SMILES | CC(C)(C)C1=CC2=CC=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@]2(C[Si](C)(C)C)[C@]34C[Si](C)(C)C |
| InChI | InChI=1S/C32H48Si2/c1-29(2,3)27-17-23-13-15-25-19-28(30(4,5)6)20-26-16-14-24(18-27)31(23,21-33(7,8)9)32(25,26)22-34(10,11)12/h13-20H,21-22H2,1-12H3/t31-,32- |
| InChIKey | DMBSOTGATQUHLA-UEOVJWFCSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane?
The IUPAC name of [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane (CID 10505167) is [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane.
What is the SMILES notation for [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane?
The canonical SMILES for [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane is CC(C)(C)C1=CC2=CC=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@]2(C[Si](C)(C)C)[C@]34C[Si](C)(C)C.
What is the InChIKey of [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane?
The InChIKey is DMBSOTGATQUHLA-UEOVJWFCSA-N. The full InChI is InChI=1S/C32H48Si2/c1-29(2,3)27-17-23-13-15-25-19-28(30(4,5)6)20-26-16-14-24(18-27)31(23,21-33(7,8)9)32(25,26)22-34(10,11)12/h13-20H,21-22H2,1-12H3/t31-,32-.
What are the key properties of [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane?
[2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane has a molecular weight of 488.91 g/mol, XLogP of 9.90, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,7-ditert-butyl-10c-(trimethylsilylmethyl)pyren-10b-yl]methyl-trimethylsilane is sourced from PubChem (CID 10505167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).