C17H21NO2 — CID 105051741
(3-cyclopropyloxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine (PubChem CID 105051741) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine.
| Compound Name | (3-cyclopropyloxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine |
|---|---|
| PubChem CID | 105051741 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanamine |
| SMILES | Cc1oc(C)c(C(N)c2cccc(OC3CC3)c2)c1C |
| InChI | InChI=1S/C17H21NO2/c1-10-11(2)19-12(3)16(10)17(18)13-5-4-6-15(9-13)20-14-7-8-14/h4-6,9,14,17H,7-8,18H2,1-3H3 |
| InChIKey | HBHPGWWQHCCZBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |