C29H30N2O6 — CID 1050525
cyclohexyl (4S,7R)-4-(4-hydroxy-3-nitrophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1050525) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is cyclohexyl (4S,7R)-4-(4-hydroxy-3-nitrophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4S,7R)-4-(4-hydroxy-3-nitrophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1050525 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | cyclohexyl (4S,7R)-4-(4-hydroxy-3-nitrophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)[C@@H](c2ccc(O)c([N+](=O)[O-])c2)C2=C(C[C@@H](c3ccccc3)CC2=O)N1 |
| InChI | InChI=1S/C29H30N2O6/c1-17-26(29(34)37-21-10-6-3-7-11-21)27(19-12-13-24(32)23(15-19)31(35)36)28-22(30-17)14-20(16-25(28)33)18-8-4-2-5-9-18/h2,4-5,8-9,12-13,15,20-21,27,30,32H,3,6-7,10-11,14,16H2,1H3/t20-,27-/m1/s1 |
| InChIKey | RATGILKHGUOGSA-NFQMXDRXSA-N |
| XLogP | 5.54 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|