C21H15Cl3N4O2S — CID 10505337
3-[(4-chloro-3-methylphenoxy)methyl]-4-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 10505337) has the molecular formula C21H15Cl3N4O2S and a molecular weight of 493.80 g/mol. Its IUPAC name is 3-[(4-chloro-3-methylphenoxy)methyl]-4-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10505337 |
| Molecular Formula | C21H15Cl3N4O2S |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 3-[(4-chloro-3-methylphenoxy)methyl]-4-[(E)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(OCc2n[nH]c(=S)n2/N=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)ccc1Cl |
| InChI | InChI=1S/C21H15Cl3N4O2S/c1-12-8-14(3-6-17(12)23)29-11-20-26-27-21(31)28(20)25-10-15-4-7-19(30-15)16-5-2-13(22)9-18(16)24/h2-10H,11H2,1H3,(H,27,31)/b25-10+ |
| InChIKey | IKEJHGLLMOYVBB-KIBLKLHPSA-N |
| XLogP | 6.93 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|