C18H27NO — CID 105053721
N-[(3-cyclobutylphenyl)-(3-methyloxolan-2-yl)methyl]ethanamine (PubChem CID 105053721) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[(3-cyclobutylphenyl)-(3-methyloxolan-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-cyclobutylphenyl)-(3-methyloxolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105053721 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-[(3-cyclobutylphenyl)-(3-methyloxolan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(C2CCC2)c1)C1OCCC1C |
| InChI | InChI=1S/C18H27NO/c1-3-19-17(18-13(2)10-11-20-18)16-9-5-8-15(12-16)14-6-4-7-14/h5,8-9,12-14,17-19H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | JGSLIAQQQKQUSI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |