C13H24BrN3 — CID 105054370
1-(4-bromo-1-methylpyrazol-5-yl)-2-methyl-N-propylpentan-1-amine (PubChem CID 105054370) has the molecular formula C13H24BrN3 and a molecular weight of 302.26 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-2-methyl-N-propylpentan-1-amine.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 105054370 |
| Molecular Formula | C13H24BrN3 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2-methyl-N-propylpentan-1-amine |
| SMILES | CCCNC(c1c(Br)cnn1C)C(C)CCC |
| InChI | InChI=1S/C13H24BrN3/c1-5-7-10(3)12(15-8-6-2)13-11(14)9-16-17(13)4/h9-10,12,15H,5-8H2,1-4H3 |
| InChIKey | JUCUEBWFYJBZIX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |