C13H14Cl2FN3O — CID 105054549
(2-chloro-6-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanamine (PubChem CID 105054549) has the molecular formula C13H14Cl2FN3O and a molecular weight of 318.18 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanamine.
| Compound Name | (2-chloro-6-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 105054549 |
| Molecular Formula | C13H14Cl2FN3O |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]methanamine |
| SMILES | COCCn1ncc(Cl)c1C(N)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2FN3O/c1-20-6-5-19-13(9(15)7-18-19)12(17)11-8(14)3-2-4-10(11)16/h2-4,7,12H,5-6,17H2,1H3 |
| InChIKey | PPYFAUWZRIUEIM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |