C15H26ClN3O2 — CID 105054576
N-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(5-methyloxolan-2-yl)methyl]propan-1-amine (PubChem CID 105054576) has the molecular formula C15H26ClN3O2 and a molecular weight of 315.85 g/mol. Its IUPAC name is N-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(5-methyloxolan-2-yl)methyl]propan-1-amine.
| Compound Name | N-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(5-methyloxolan-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105054576 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(5-methyloxolan-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1c(Cl)cnn1CCOC)C1CCC(C)O1 |
| InChI | InChI=1S/C15H26ClN3O2/c1-4-7-17-14(13-6-5-11(2)21-13)15-12(16)10-18-19(15)8-9-20-3/h10-11,13-14,17H,4-9H2,1-3H3 |
| InChIKey | NPDDAPJWOFXGHL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |