C22H30N2O11 — CID 10505478
diethyl 2-[(3R,5S)-5-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate (PubChem CID 10505478) has the molecular formula C22H30N2O11 and a molecular weight of 498.49 g/mol. Its IUPAC name is diethyl 2-[(3R,5S)-5-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3R,5S)-5-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 10505478 |
| Molecular Formula | C22H30N2O11 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | diethyl 2-[(3R,5S)-5-(1,3-diethoxy-1,3-dioxopropan-2-yl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CO[C@@](C(C(=O)OCC)C(=O)OCC)(n2ccc(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C22H30N2O11/c1-5-31-17(26)15(18(27)32-6-2)13-11-22(35-12-13,24-10-9-14(25)23-21(24)30)16(19(28)33-7-3)20(29)34-8-4/h9-10,13,15-16H,5-8,11-12H2,1-4H3,(H,23,25,30)/t13-,22-/m0/s1 |
| InChIKey | POEBALJHOFMEGJ-XMHCIUCPSA-N |
| XLogP | -0.29 |
| TPSA | 169.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|