C14H18F5NO — CID 105054797
4-methoxy-1-(2,3,4,5,6-pentafluorophenyl)-N-propylbutan-1-amine (PubChem CID 105054797) has the molecular formula C14H18F5NO and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-methoxy-1-(2,3,4,5,6-pentafluorophenyl)-N-propylbutan-1-amine.
| Compound Name | 4-methoxy-1-(2,3,4,5,6-pentafluorophenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 105054797 |
| Molecular Formula | C14H18F5NO |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-methoxy-1-(2,3,4,5,6-pentafluorophenyl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCOC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H18F5NO/c1-3-6-20-8(5-4-7-21-2)9-10(15)12(17)14(19)13(18)11(9)16/h8,20H,3-7H2,1-2H3 |
| InChIKey | VCPUMRFVKRDFKA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|