About 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide
1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide (PubChem CID 105055851) has the molecular formula C12H21F3N2O2S
and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide |
| PubChem CID | 105055851 |
| Molecular Formula | C12H21F3N2O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NCCSC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C12H21F3N2O2S/c1-4-19-8-7-11(16,10(8,2)3)9(18)17-5-6-20-12(13,14)15/h8H,4-7,16H2,1-3H3,(H,17,18) |
| InChIKey | VZZKOXXZAQARTC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide?
The IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide (CID 105055851) is 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide.
What is the SMILES notation for 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide?
The canonical SMILES for 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide is CCOC1CC(N)(C(=O)NCCSC(F)(F)F)C1(C)C.
What is the InChIKey of 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide?
The InChIKey is VZZKOXXZAQARTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2S/c1-4-19-8-7-11(16,10(8,2)3)9(18)17-5-6-20-12(13,14)15/h8H,4-7,16H2,1-3H3,(H,17,18).
What are the key properties of 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide?
1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide has a molecular weight of 314.37 g/mol, XLogP of 1.89, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-ethoxy-2,2-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclobutane-1-carboxamide is sourced from PubChem (CID 105055851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).