About 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide
4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide (PubChem CID 105055906) has the molecular formula C8H13ClN2O3S2
and a molecular weight of 284.79 g/mol. Its IUPAC name is 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide |
| PubChem CID | 105055906 |
| Molecular Formula | C8H13ClN2O3S2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)CCCCCl)cs1 |
| InChI | InChI=1S/C8H13ClN2O3S2/c9-3-1-2-4-16(13,14)10-5-7-6-15-8(12)11-7/h6,10H,1-5H2,(H,11,12) |
| InChIKey | NWHBSGBYZSXKRK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The IUPAC name of 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide (CID 105055906) is 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide.
What is the SMILES notation for 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The canonical SMILES for 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide is O=c1[nH]c(CNS(=O)(=O)CCCCCl)cs1.
What is the InChIKey of 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
The InChIKey is NWHBSGBYZSXKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2O3S2/c9-3-1-2-4-16(13,14)10-5-7-6-15-8(12)11-7/h6,10H,1-5H2,(H,11,12).
What are the key properties of 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide?
4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide has a molecular weight of 284.79 g/mol, XLogP of 0.87, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butane-1-sulfonamide is sourced from PubChem (CID 105055906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).