About 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide
1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide (PubChem CID 105055923) has the molecular formula C14H26N2O2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide |
| PubChem CID | 105055923 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide |
| SMILES | C=CCSCCNC(=O)C1(N)CC(OCC)C1(C)C |
| InChI | InChI=1S/C14H26N2O2S/c1-5-8-19-9-7-16-12(17)14(15)10-11(18-6-2)13(14,3)4/h5,11H,1,6-10,15H2,2-4H3,(H,16,17) |
| InChIKey | UWSVKJAFJXBOID-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide?
The IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide (CID 105055923) is 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide is C=CCSCCNC(=O)C1(N)CC(OCC)C1(C)C.
What is the InChIKey of 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide?
The InChIKey is UWSVKJAFJXBOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2S/c1-5-8-19-9-7-16-12(17)14(15)10-11(18-6-2)13(14,3)4/h5,11H,1,6-10,15H2,2-4H3,(H,16,17).
What are the key properties of 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide?
1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide has a molecular weight of 286.44 g/mol, XLogP of 1.55, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-ethoxy-2,2-dimethyl-N-(2-prop-2-enylsulfanylethyl)cyclobutane-1-carboxamide is sourced from PubChem (CID 105055923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).