About 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide
4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide (PubChem CID 105056147) has the molecular formula C8H15ClF3NO2S
and a molecular weight of 281.73 g/mol. Its IUPAC name is 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide |
| PubChem CID | 105056147 |
| Molecular Formula | C8H15ClF3NO2S |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)CCCCCl |
| InChI | InChI=1S/C8H15ClF3NO2S/c1-7(6-8(10,11)12)13-16(14,15)5-3-2-4-9/h7,13H,2-6H2,1H3 |
| InChIKey | MMBGZZAHWNNFGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide?
The IUPAC name of 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide (CID 105056147) is 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide.
What is the SMILES notation for 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide?
The canonical SMILES for 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide is CC(CC(F)(F)F)NS(=O)(=O)CCCCCl.
What is the InChIKey of 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide?
The InChIKey is MMBGZZAHWNNFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClF3NO2S/c1-7(6-8(10,11)12)13-16(14,15)5-3-2-4-9/h7,13H,2-6H2,1H3.
What are the key properties of 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide?
4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide has a molecular weight of 281.73 g/mol, XLogP of 2.27, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,4,4-trifluorobutan-2-yl)butane-1-sulfonamide is sourced from PubChem (CID 105056147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).