C16H17BrClNO2 — CID 105056645
(4-bromo-2,5-dimethoxyphenyl)-(3-chloro-4-methylphenyl)methanamine (PubChem CID 105056645) has the molecular formula C16H17BrClNO2 and a molecular weight of 370.67 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)-(3-chloro-4-methylphenyl)methanamine.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)-(3-chloro-4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 105056645 |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)-(3-chloro-4-methylphenyl)methanamine |
| SMILES | COc1cc(C(N)c2ccc(C)c(Cl)c2)c(OC)cc1Br |
| InChI | InChI=1S/C16H17BrClNO2/c1-9-4-5-10(6-13(9)18)16(19)11-7-15(21-3)12(17)8-14(11)20-2/h4-8,16H,19H2,1-3H3 |
| InChIKey | XPYIKYKPTGBUCT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |