C24H24Br2O2 — CID 10505686
1,2-dibromo-4,5-bis[(2,5-dimethylphenyl)methoxy]benzene (PubChem CID 10505686) has the molecular formula C24H24Br2O2 and a molecular weight of 504.26 g/mol. Its IUPAC name is 1,2-dibromo-4,5-bis[(2,5-dimethylphenyl)methoxy]benzene.
| Compound Name | 1,2-dibromo-4,5-bis[(2,5-dimethylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 10505686 |
| Molecular Formula | C24H24Br2O2 |
| Molecular Weight | 504.26 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 1,2-dibromo-4,5-bis[(2,5-dimethylphenyl)methoxy]benzene |
| SMILES | Cc1ccc(C)c(COc2cc(Br)c(Br)cc2OCc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H24Br2O2/c1-15-5-7-17(3)19(9-15)13-27-23-11-21(25)22(26)12-24(23)28-14-20-10-16(2)6-8-18(20)4/h5-12H,13-14H2,1-4H3 |
| InChIKey | ZMGWTTOCKDPNNS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.26 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |