C30H45FO5 — CID 10505706
[(1R,4S,5'S,6R,7S,8R,9R,10S,12S,13S,15S,16S,18S)-15-fluoro-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-2-ene-6,2'-oxane]-10-yl] propanoate (PubChem CID 10505706) has the molecular formula C30H45FO5 and a molecular weight of 504.68 g/mol. Its IUPAC name is [(1R,4S,5'S,6R,7S,8R,9R,10S,12S,13S,15S,16S,18S)-15-fluoro-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-2-ene-6,2'-oxane]-10-yl] propanoate.
| Compound Name | [(1R,4S,5'S,6R,7S,8R,9R,10S,12S,13S,15S,16S,18S)-15-fluoro-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-2-ene-6,2'-oxane]-10-yl] propanoate |
|---|---|
| PubChem CID | 10505706 |
| Molecular Formula | C30H45FO5 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | [(1R,4S,5'S,6R,7S,8R,9R,10S,12S,13S,15S,16S,18S)-15-fluoro-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-2-ene-6,2'-oxane]-10-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C[C@H]2[C@@H](CC[C@H]3C[C@H](O)[C@@H](F)C[C@@]32C)C2=C[C@@H]3O[C@]4(CC[C@H](C)CO4)[C@@H](C)[C@@H]3[C@]21C |
| InChI | InChI=1S/C30H45FO5/c1-6-26(33)35-25-13-20-19(8-7-18-11-23(32)22(31)14-28(18,20)4)21-12-24-27(29(21,25)5)17(3)30(36-24)10-9-16(2)15-34-30/h12,16-20,22-25,27,32H,6-11,13-15H2,1-5H3/t16-,17-,18-,19+,20-,22-,23-,24-,25-,27-,28-,29+,30+/m0/s1 |
| InChIKey | LSOUGHAHCFYQEX-KHVWCLRLSA-N |
| XLogP | 5.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|