C12H14BrClO2 — CID 105057519
7-bromo-1-chloro-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 105057519) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 7-bromo-1-chloro-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-bromo-1-chloro-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 105057519 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 7-bromo-1-chloro-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc(Br)c(OC)c2c1CCCC2Cl |
| InChI | InChI=1S/C12H14BrClO2/c1-15-10-6-8(13)12(16-2)11-7(10)4-3-5-9(11)14/h6,9H,3-5H2,1-2H3 |
| InChIKey | PBXLFYORFDISAI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|