C31H32N2O5 — CID 10505927
(1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-8-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 10505927) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-8-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-8-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 10505927 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (1R,3R)-7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-1,3-dimethyl-8-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cccc2c(-c3ccc4c(c3OCc3ccc([N+](=O)[O-])cc3)[C@@H](C)N[C@H](C)C4)c(C)cc(OC)c12 |
| InChI | InChI=1S/C31H32N2O5/c1-18-15-27(37-5)30-24(7-6-8-26(30)36-4)28(18)25-14-11-22-16-19(2)32-20(3)29(22)31(25)38-17-21-9-12-23(13-10-21)33(34)35/h6-15,19-20,32H,16-17H2,1-5H3/t19-,20-/m1/s1 |
| InChIKey | XFNODTTZVPTIHU-WOJBJXKFSA-N |
| XLogP | 6.91 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|