C17H17ClFNO — CID 105059795
N-(1-chloro-2-phenylpropan-2-yl)-5-fluoro-2-methylbenzamide (PubChem CID 105059795) has the molecular formula C17H17ClFNO and a molecular weight of 305.78 g/mol. Its IUPAC name is N-(1-chloro-2-phenylpropan-2-yl)-5-fluoro-2-methylbenzamide.
| Compound Name | N-(1-chloro-2-phenylpropan-2-yl)-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 105059795 |
| Molecular Formula | C17H17ClFNO |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-(1-chloro-2-phenylpropan-2-yl)-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)NC(C)(CCl)c1ccccc1 |
| InChI | InChI=1S/C17H17ClFNO/c1-12-8-9-14(19)10-15(12)16(21)20-17(2,11-18)13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,20,21) |
| InChIKey | XGFBBPBPWIEFKS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|