ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate

C9H11FN2O4 — CID 105061568

IUPACethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate
SMILESCCOC(=O)C(F)n1nc(OC)ccc1=O
InChIInChI=1S/C9H11FN2O4/c1-3-16-9(14)8(10)12-7(13)5-4-6(11-12)15-2/h4-5,8H,3H2,1-2H3
InChIKeyCBSBZIRINAXTDI-UHFFFAOYSA-N
MW230.19 g/mol
LogP0.28
Rot. Bonds4

About ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate

ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate (PubChem CID 105061568) has the molecular formula C9H11FN2O4 and a molecular weight of 230.19 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate.

Molecular Properties

Compound Nameethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate
PubChem CID105061568
Molecular FormulaC9H11FN2O4
Molecular Weight230.19 g/mol
Exact Mass230.07
IUPAC Nameethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate
SMILESCCOC(=O)C(F)n1nc(OC)ccc1=O
InChIInChI=1S/C9H11FN2O4/c1-3-16-9(14)8(10)12-7(13)5-4-6(11-12)15-2/h4-5,8H,3H2,1-2H3
InChIKeyCBSBZIRINAXTDI-UHFFFAOYSA-N
XLogP0.28
TPSA70.42 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.19
LogP ≤ 50.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate?
The IUPAC name of ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate (CID 105061568) is ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate.
What is the SMILES notation for ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate?
The canonical SMILES for ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate is CCOC(=O)C(F)n1nc(OC)ccc1=O.
What is the InChIKey of ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate?
The InChIKey is CBSBZIRINAXTDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O4/c1-3-16-9(14)8(10)12-7(13)5-4-6(11-12)15-2/h4-5,8H,3H2,1-2H3.
What are the key properties of ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate?
ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate has a molecular weight of 230.19 g/mol, XLogP of 0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-(3-methoxy-6-oxopyridazin-1-yl)acetate is sourced from PubChem (CID 105061568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).