About 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile
5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 105061796) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile |
| PubChem CID | 105061796 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | COc1ccc(=O)n(CCCC(C)(C)C#N)n1 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2,9-13)7-4-8-15-11(16)6-5-10(14-15)17-3/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | PKFKJFISLYQBFL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile?
The IUPAC name of 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile (CID 105061796) is 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile is COc1ccc(=O)n(CCCC(C)(C)C#N)n1.
What is the InChIKey of 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile?
The InChIKey is PKFKJFISLYQBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-12(2,9-13)7-4-8-15-11(16)6-5-10(14-15)17-3/h5-6H,4,7-8H2,1-3H3.
What are the key properties of 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile?
5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile has a molecular weight of 235.29 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxy-6-oxopyridazin-1-yl)-2,2-dimethylpentanenitrile is sourced from PubChem (CID 105061796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).