C8H12N2O4 — CID 105061939
2-(2,3-dihydroxypropyl)-6-methoxypyridazin-3-one (PubChem CID 105061939) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-6-methoxypyridazin-3-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-6-methoxypyridazin-3-one |
|---|---|
| PubChem CID | 105061939 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-6-methoxypyridazin-3-one |
| SMILES | COc1ccc(=O)n(CC(O)CO)n1 |
| InChI | InChI=1S/C8H12N2O4/c1-14-7-2-3-8(13)10(9-7)4-6(12)5-11/h2-3,6,11-12H,4-5H2,1H3 |
| InChIKey | JXNYPSHZWOKRRQ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |