C32H49NO3Si — CID 10506236
N-[(Z,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxytetradec-7-en-2-yl]acetamide (PubChem CID 10506236) has the molecular formula C32H49NO3Si and a molecular weight of 523.83 g/mol. Its IUPAC name is N-[(Z,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxytetradec-7-en-2-yl]acetamide.
| Compound Name | N-[(Z,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxytetradec-7-en-2-yl]acetamide |
|---|---|
| PubChem CID | 10506236 |
| Molecular Formula | C32H49NO3Si |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | N-[(Z,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxytetradec-7-en-2-yl]acetamide |
| SMILES | CCCCCC/C=C\CCC[C@@H](O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C32H49NO3Si/c1-6-7-8-9-10-11-12-13-20-25-31(35)30(33-27(2)34)26-36-37(32(3,4)5,28-21-16-14-17-22-28)29-23-18-15-19-24-29/h11-12,14-19,21-24,30-31,35H,6-10,13,20,25-26H2,1-5H3,(H,33,34)/b12-11-/t30-,31-/m1/s1 |
| InChIKey | RFTKWFRBULUFTI-UZZXDRJWSA-N |
| XLogP | 6.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|