C11H13N3O2 — CID 105063443
N-(cyanomethyl)-N-ethyl-3-methoxypyridine-4-carboxamide (PubChem CID 105063443) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-(cyanomethyl)-N-ethyl-3-methoxypyridine-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N-ethyl-3-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 105063443 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-(cyanomethyl)-N-ethyl-3-methoxypyridine-4-carboxamide |
| SMILES | CCN(CC#N)C(=O)c1ccncc1OC |
| InChI | InChI=1S/C11H13N3O2/c1-3-14(7-5-12)11(15)9-4-6-13-8-10(9)16-2/h4,6,8H,3,7H2,1-2H3 |
| InChIKey | NWXXLRXWKXYZBU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|