C28H52O7Si — CID 10506355
tert-butyl 2-[(2S,4S,6S,8R,10S)-10-hydroxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 10506355) has the molecular formula C28H52O7Si and a molecular weight of 528.80 g/mol. Its IUPAC name is tert-butyl 2-[(2S,4S,6S,8R,10S)-10-hydroxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-hydroxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 10506355 |
| Molecular Formula | C28H52O7Si |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | tert-butyl 2-[(2S,4S,6S,8R,10S)-10-hydroxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](O)C[C@H](CC(=O)OC(C)(C)C)O2)O1)[C@@H](C)CO |
| InChI | InChI=1S/C28H52O7Si/c1-10-36(11-2,12-3)35-27(9)17-24(13-20(4)21(5)18-29)33-28(19-27)16-22(30)14-23(32-28)15-25(31)34-26(6,7)8/h21-24,29-30H,4,10-19H2,1-3,5-9H3/t21-,22-,23+,24-,27-,28+/m0/s1 |
| InChIKey | HOMRVWCSLKXNPB-NBYJONQWSA-N |
| XLogP | 5.49 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|