About 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride
3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride (PubChem CID 105064798) has the molecular formula C8H7ClN4O3S
and a molecular weight of 274.69 g/mol. Its IUPAC name is 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
| PubChem CID | 105064798 |
| Molecular Formula | C8H7ClN4O3S |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
| SMILES | COc1cnccc1-c1n[nH]c(S(=O)(=O)Cl)n1 |
| InChI | InChI=1S/C8H7ClN4O3S/c1-16-6-4-10-3-2-5(6)7-11-8(13-12-7)17(9,14)15/h2-4H,1H3,(H,11,12,13) |
| InChIKey | SUMLJIPHDILRLC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The IUPAC name of 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride (CID 105064798) is 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride.
What is the SMILES notation for 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The canonical SMILES for 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride is COc1cnccc1-c1n[nH]c(S(=O)(=O)Cl)n1.
What is the InChIKey of 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
The InChIKey is SUMLJIPHDILRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O3S/c1-16-6-4-10-3-2-5(6)7-11-8(13-12-7)17(9,14)15/h2-4H,1H3,(H,11,12,13).
What are the key properties of 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride?
3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride has a molecular weight of 274.69 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxy-4-pyridinyl)-1H-1,2,4-triazole-5-sulfonyl chloride is sourced from PubChem (CID 105064798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).