C29H24Cl2N2O4 — CID 10506495
prop-2-enyl 1-benzyl-6-(4-carbamoylphenyl)-4-(2,6-dichlorophenyl)-2-oxo-3,4-dihydropyridine-3-carboxylate (PubChem CID 10506495) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is prop-2-enyl 1-benzyl-6-(4-carbamoylphenyl)-4-(2,6-dichlorophenyl)-2-oxo-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl 1-benzyl-6-(4-carbamoylphenyl)-4-(2,6-dichlorophenyl)-2-oxo-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10506495 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | prop-2-enyl 1-benzyl-6-(4-carbamoylphenyl)-4-(2,6-dichlorophenyl)-2-oxo-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)N(Cc2ccccc2)C(c2ccc(C(N)=O)cc2)=CC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H24Cl2N2O4/c1-2-15-37-29(36)26-21(25-22(30)9-6-10-23(25)31)16-24(19-11-13-20(14-12-19)27(32)34)33(28(26)35)17-18-7-4-3-5-8-18/h2-14,16,21,26H,1,15,17H2,(H2,32,34) |
| InChIKey | QHDWBBBWVJGNGH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|