C30H48O6S — CID 10506530
[(1S,3aR,4S,7aR)-1-[(1R)-1-[2-[(4S)-5,5-diethyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 4-methylbenzenesulfonate (PubChem CID 10506530) has the molecular formula C30H48O6S and a molecular weight of 536.78 g/mol. Its IUPAC name is [(1S,3aR,4S,7aR)-1-[(1R)-1-[2-[(4S)-5,5-diethyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3aR,4S,7aR)-1-[(1R)-1-[2-[(4S)-5,5-diethyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10506530 |
| Molecular Formula | C30H48O6S |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | [(1S,3aR,4S,7aR)-1-[(1R)-1-[2-[(4S)-5,5-diethyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 4-methylbenzenesulfonate |
| SMILES | CCC1(CC)OC(C)(C)O[C@H]1CCO[C@H](C)[C@H]1CC[C@H]2[C@@H](OS(=O)(=O)c3ccc(C)cc3)CCC[C@]12C |
| InChI | InChI=1S/C30H48O6S/c1-8-30(9-2)27(34-28(5,6)36-30)18-20-33-22(4)24-16-17-25-26(11-10-19-29(24,25)7)35-37(31,32)23-14-12-21(3)13-15-23/h12-15,22,24-27H,8-11,16-20H2,1-7H3/t22-,24-,25+,26+,27+,29-/m1/s1 |
| InChIKey | KOPHHDBTHOGEFV-INASAMPOSA-N |
| XLogP | 6.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|