C30H56O4Si2 — CID 10506535
(1S,2R,3R,4R,7S,8R)-4-butyl-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-5,9-dien-3-ol (PubChem CID 10506535) has the molecular formula C30H56O4Si2 and a molecular weight of 536.95 g/mol. Its IUPAC name is (1S,2R,3R,4R,7S,8R)-4-butyl-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-5,9-dien-3-ol.
| Compound Name | (1S,2R,3R,4R,7S,8R)-4-butyl-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-5,9-dien-3-ol |
|---|---|
| PubChem CID | 10506535 |
| Molecular Formula | C30H56O4Si2 |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | (1S,2R,3R,4R,7S,8R)-4-butyl-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-5,9-dien-3-ol |
| SMILES | CCCC[C@@H]1C=C(C)[C@]2(CO[Si](C)(C)C(C)(C)C)[C@H]3C=C[C@](C)(O3)[C@]2(CO[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C30H56O4Si2/c1-14-15-16-23-19-22(2)29(20-32-35(10,11)26(3,4)5)24-17-18-28(9,34-24)30(29,25(23)31)21-33-36(12,13)27(6,7)8/h17-19,23-25,31H,14-16,20-21H2,1-13H3/t23-,24-,25-,28+,29-,30+/m1/s1 |
| InChIKey | NTVFGZUCDOKTKU-NUJRXVLOSA-N |
| XLogP | 7.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|