C17H22N2O2 — CID 105065538
1-(3-methoxy-4-pyridinyl)-N-methyl-1-(4-propoxyphenyl)methanamine (PubChem CID 105065538) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(3-methoxy-4-pyridinyl)-N-methyl-1-(4-propoxyphenyl)methanamine.
| Compound Name | 1-(3-methoxy-4-pyridinyl)-N-methyl-1-(4-propoxyphenyl)methanamine |
|---|---|
| PubChem CID | 105065538 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(3-methoxy-4-pyridinyl)-N-methyl-1-(4-propoxyphenyl)methanamine |
| SMILES | CCCOc1ccc(C(NC)c2ccncc2OC)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-11-21-14-7-5-13(6-8-14)17(18-2)15-9-10-19-12-16(15)20-3/h5-10,12,17-18H,4,11H2,1-3H3 |
| InChIKey | LZIFIVUYMXJXPO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |