C16H19NO2 — CID 105066190
2-(4-ethylphenyl)-1-(3-methoxy-4-pyridinyl)ethanol (PubChem CID 105066190) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-(3-methoxy-4-pyridinyl)ethanol.
| Compound Name | 2-(4-ethylphenyl)-1-(3-methoxy-4-pyridinyl)ethanol |
|---|---|
| PubChem CID | 105066190 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-(4-ethylphenyl)-1-(3-methoxy-4-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2ccncc2OC)cc1 |
| InChI | InChI=1S/C16H19NO2/c1-3-12-4-6-13(7-5-12)10-15(18)14-8-9-17-11-16(14)19-2/h4-9,11,15,18H,3,10H2,1-2H3 |
| InChIKey | ZMXGWBICALQWCI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |