C32H48N8 — CID 10506740
1,6,9,14,17,22,25,30-octazapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-3,11,19,27-tetrayne (PubChem CID 10506740) has the molecular formula C32H48N8 and a molecular weight of 544.79 g/mol. Its IUPAC name is 1,6,9,14,17,22,25,30-octazapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-3,11,19,27-tetrayne.
| Compound Name | 1,6,9,14,17,22,25,30-octazapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-3,11,19,27-tetrayne |
|---|---|
| PubChem CID | 10506740 |
| Molecular Formula | C32H48N8 |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | 1,6,9,14,17,22,25,30-octazapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-3,11,19,27-tetrayne |
| SMILES | C1#CCN2CCN(CC#CCN3CCN(CC#CCN4CCN(CC#CCN5CCN(C1)CC5)CC4)CC3)CC2 |
| InChI | InChI=1S/C32H48N8/c1-2-10-34-21-23-36(24-22-34)12-5-6-14-38-29-31-40(32-30-38)16-8-7-15-39-27-25-37(26-28-39)13-4-3-11-35-19-17-33(9-1)18-20-35/h9-32H2 |
| InChIKey | FMGOZJKNZYXAPA-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|