C30H30N2O8 — CID 10506786
[3-acetyloxy-5-[(1S,2R,6S,7R)-7-(3,5-diacetyloxyphenyl)-10,10-dimethyl-8,9-diazatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]phenyl] acetate (PubChem CID 10506786) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is [3-acetyloxy-5-[(1S,2R,6S,7R)-7-(3,5-diacetyloxyphenyl)-10,10-dimethyl-8,9-diazatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[(1S,2R,6S,7R)-7-(3,5-diacetyloxyphenyl)-10,10-dimethyl-8,9-diazatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 10506786 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | [3-acetyloxy-5-[(1S,2R,6S,7R)-7-(3,5-diacetyloxyphenyl)-10,10-dimethyl-8,9-diazatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc([C@@]23N=N[C@@](c4cc(OC(C)=O)cc(OC(C)=O)c4)([C@H]4C=CC[C@H]42)C3(C)C)c1 |
| InChI | InChI=1S/C30H30N2O8/c1-16(33)37-22-10-20(11-23(14-22)38-17(2)34)29-26-8-7-9-27(26)30(32-31-29,28(29,5)6)21-12-24(39-18(3)35)15-25(13-21)40-19(4)36/h7-8,10-15,26-27H,9H2,1-6H3/t26-,27+,29-,30+/m0/s1 |
| InChIKey | JQXULUJQZMIRNL-GCRMGGTCSA-N |
| XLogP | 5.18 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|