C25H29F3N4O7 — CID 10506940
2-[3-(2,2-dimethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl)acetamide (PubChem CID 10506940) has the molecular formula C25H29F3N4O7 and a molecular weight of 554.52 g/mol. Its IUPAC name is 2-[3-(2,2-dimethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl)acetamide.
| Compound Name | 2-[3-(2,2-dimethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl)acetamide |
|---|---|
| PubChem CID | 10506940 |
| Molecular Formula | C25H29F3N4O7 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-[3-(2,2-dimethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl)acetamide |
| SMILES | COC(Cn1c(=O)[nH]c2c(=O)n(CC(=O)NC(C(C)C)C(O)C(F)(F)F)c(-c3ccccc3)cc2c1=O)OC |
| InChI | InChI=1S/C25H29F3N4O7/c1-13(2)19(21(34)25(26,27)28)29-17(33)11-31-16(14-8-6-5-7-9-14)10-15-20(23(31)36)30-24(37)32(22(15)35)12-18(38-3)39-4/h5-10,13,18-19,21,34H,11-12H2,1-4H3,(H,29,33)(H,30,37) |
| InChIKey | BGIRPYBEVLSWIM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|