C13H14BrN3OS — CID 105070295
N-[(5-bromothiophen-2-yl)methyl]-3-(ethylamino)pyridine-4-carboxamide (PubChem CID 105070295) has the molecular formula C13H14BrN3OS and a molecular weight of 340.25 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-(ethylamino)pyridine-4-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105070295 |
| Molecular Formula | C13H14BrN3OS |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H14BrN3OS/c1-2-16-11-8-15-6-5-10(11)13(18)17-7-9-3-4-12(14)19-9/h3-6,8,16H,2,7H2,1H3,(H,17,18) |
| InChIKey | ZTPBLEBYQOMSKI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |