C29H54O8Si — CID 10507049
tert-butyl 2-[(4R,5R)-5-[(E,3R)-4-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-hydroxybut-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 10507049) has the molecular formula C29H54O8Si and a molecular weight of 558.83 g/mol. Its IUPAC name is tert-butyl 2-[(4R,5R)-5-[(E,3R)-4-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-hydroxybut-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,5R)-5-[(E,3R)-4-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-hydroxybut-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 10507049 |
| Molecular Formula | C29H54O8Si |
| Molecular Weight | 558.83 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | tert-butyl 2-[(4R,5R)-5-[(E,3R)-4-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-hydroxybut-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1OC(C)(C)O[C@@H]1/C=C/[C@H](O)C[C@@H]1C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C29H54O8Si/c1-26(2,3)37-25(31)19-24-23(35-29(9,10)36-24)14-13-20(30)17-22-18-21(33-28(7,8)34-22)15-16-32-38(11,12)27(4,5)6/h13-14,20-24,30H,15-19H2,1-12H3/b14-13+/t20-,21-,22+,23+,24+/m0/s1 |
| InChIKey | OKDPSWJAWIETFR-WQAWENRGSA-N |
| XLogP | 5.87 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.83 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|